C15H28N2O — CID 15906528
(1S,2S,4R)-1-methyl-2-(4-methylpiperazin-1-yl)-4-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 15906528) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (1S,2S,4R)-1-methyl-2-(4-methylpiperazin-1-yl)-4-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2S,4R)-1-methyl-2-(4-methylpiperazin-1-yl)-4-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 15906528 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (1S,2S,4R)-1-methyl-2-(4-methylpiperazin-1-yl)-4-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(O)[C@@H](N2CCN(C)CC2)C1 |
| InChI | InChI=1S/C15H28N2O/c1-12(2)13-5-6-15(3,18)14(11-13)17-9-7-16(4)8-10-17/h13-14,18H,1,5-11H2,2-4H3/t13-,14+,15+/m1/s1 |
| InChIKey | SSQBZBOINSZHQD-ILXRZTDVSA-N |
| XLogP | 1.73 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|