C14H25NO2 — CID 22625205
1-methyl-2-morpholin-4-yl-4-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 22625205) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-methyl-2-morpholin-4-yl-4-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | 1-methyl-2-morpholin-4-yl-4-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 22625205 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 1-methyl-2-morpholin-4-yl-4-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)C1CCC(C)(O)C(N2CCOCC2)C1 |
| InChI | InChI=1S/C14H25NO2/c1-11(2)12-4-5-14(3,16)13(10-12)15-6-8-17-9-7-15/h12-13,16H,1,4-10H2,2-3H3 |
| InChIKey | YTJVBLPAMBTDCH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|