About argon;methyl 2-hydroxy-4-iodobenzoate
argon;methyl 2-hydroxy-4-iodobenzoate (PubChem CID 159067231) has the molecular formula C8H7ArIO3
and a molecular weight of 317.99 g/mol. Its IUPAC name is argon;methyl 2-hydroxy-4-iodobenzoate.
Molecular Properties
| Compound Name | argon;methyl 2-hydroxy-4-iodobenzoate |
| PubChem CID | 159067231 |
| Molecular Formula | C8H7ArIO3 |
| Molecular Weight | 317.99 g/mol |
| Exact Mass | 317.91 |
| IUPAC Name | argon;methyl 2-hydroxy-4-iodobenzoate |
| SMILES | COC(=O)c1ccc(I)cc1O.[Ar] |
| InChI | InChI=1S/C8H7IO3.Ar/c1-12-8(11)6-3-2-5(9)4-7(6)10;/h2-4,10H,1H3; |
| InChIKey | JZFBFNFMINAOSZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.99 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze argon;methyl 2-hydroxy-4-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;methyl 2-hydroxy-4-iodobenzoate?
The IUPAC name of argon;methyl 2-hydroxy-4-iodobenzoate (CID 159067231) is argon;methyl 2-hydroxy-4-iodobenzoate.
What is the SMILES notation for argon;methyl 2-hydroxy-4-iodobenzoate?
The canonical SMILES for argon;methyl 2-hydroxy-4-iodobenzoate is COC(=O)c1ccc(I)cc1O.[Ar].
What is the InChIKey of argon;methyl 2-hydroxy-4-iodobenzoate?
The InChIKey is JZFBFNFMINAOSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IO3.Ar/c1-12-8(11)6-3-2-5(9)4-7(6)10;/h2-4,10H,1H3;.
What are the key properties of argon;methyl 2-hydroxy-4-iodobenzoate?
argon;methyl 2-hydroxy-4-iodobenzoate has a molecular weight of 317.99 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for argon;methyl 2-hydroxy-4-iodobenzoate is sourced from PubChem (CID 159067231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).