About 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane
2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane (PubChem CID 159067766) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane.
Molecular Properties
| Compound Name | 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane |
| PubChem CID | 159067766 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane |
| SMILES | CC(C)(C)C1=NC=CC1.CC(C)C.c1c[nH]cn1 |
| InChI | InChI=1S/C8H13N.C4H10.C3H4N2/c1-8(2,3)7-5-4-6-9-7;1-4(2)3;1-2-5-3-4-1/h4,6H,5H2,1-3H3;4H,1-3H3;1-3H,(H,4,5) |
| InChIKey | JZGWDAOXJRHZFH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane?
The IUPAC name of 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane (CID 159067766) is 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane.
What is the SMILES notation for 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane?
The canonical SMILES for 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane is CC(C)(C)C1=NC=CC1.CC(C)C.c1c[nH]cn1.
What is the InChIKey of 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane?
The InChIKey is JZGWDAOXJRHZFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N.C4H10.C3H4N2/c1-8(2,3)7-5-4-6-9-7;1-4(2)3;1-2-5-3-4-1/h4,6H,5H2,1-3H3;4H,1-3H3;1-3H,(H,4,5).
What are the key properties of 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane?
2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane has a molecular weight of 249.40 g/mol, XLogP of 4.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3H-pyrrole;1H-imidazole;2-methylpropane is sourced from PubChem (CID 159067766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).