C16H26N2 — CID 158012129
2-tert-butyl-3H-pyrrole;5-tert-butyl-3H-pyrrole (PubChem CID 158012129) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 2-tert-butyl-3H-pyrrole;5-tert-butyl-3H-pyrrole.
| Compound Name | 2-tert-butyl-3H-pyrrole;5-tert-butyl-3H-pyrrole |
|---|---|
| PubChem CID | 158012129 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 2-tert-butyl-3H-pyrrole;5-tert-butyl-3H-pyrrole |
| SMILES | CC(C)(C)C1=CCC=N1.CC(C)(C)C1=NC=CC1 |
| InChI | InChI=1S/2C8H13N/c2*1-8(2,3)7-5-4-6-9-7/h5-6H,4H2,1-3H3;4,6H,5H2,1-3H3 |
| InChIKey | FFACWDNNHROKPG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |