C27H33NO5 — CID 159069113
benzyl 2-[4-[2-[[(2R)-2-phenylmethoxypropanoyl]amino]acetyl]cyclohexyl]acetate (PubChem CID 159069113) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is benzyl 2-[4-[2-[[(2R)-2-phenylmethoxypropanoyl]amino]acetyl]cyclohexyl]acetate.
| Compound Name | benzyl 2-[4-[2-[[(2R)-2-phenylmethoxypropanoyl]amino]acetyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 159069113 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | benzyl 2-[4-[2-[[(2R)-2-phenylmethoxypropanoyl]amino]acetyl]cyclohexyl]acetate |
| SMILES | C[C@@H](OCc1ccccc1)C(=O)NCC(=O)C1CCC(CC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H33NO5/c1-20(32-18-22-8-4-2-5-9-22)27(31)28-17-25(29)24-14-12-21(13-15-24)16-26(30)33-19-23-10-6-3-7-11-23/h2-11,20-21,24H,12-19H2,1H3,(H,28,31)/t20-,21?,24?/m1/s1 |
| InChIKey | WBVKHALGVBQZPD-UZGSZPBKSA-N |
| XLogP | 4.22 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |