C17H16N6OS — CID 159069589
N-(2-methoxy-7H-pyrrolo[3,4-b]pyridin-3-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine (PubChem CID 159069589) has the molecular formula C17H16N6OS and a molecular weight of 352.42 g/mol. Its IUPAC name is N-(2-methoxy-7H-pyrrolo[3,4-b]pyridin-3-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | N-(2-methoxy-7H-pyrrolo[3,4-b]pyridin-3-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 159069589 |
| Molecular Formula | C17H16N6OS |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-(2-methoxy-7H-pyrrolo[3,4-b]pyridin-3-yl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-amine |
| SMILES | COc1nc2c(cc1Nc1ncnc3sc4c(c13)CCNC4)C=NC2 |
| InChI | InChI=1S/C17H16N6OS/c1-24-16-11(4-9-5-19-6-12(9)23-16)22-15-14-10-2-3-18-7-13(10)25-17(14)21-8-20-15/h4-5,8,18H,2-3,6-7H2,1H3,(H,20,21,22) |
| InChIKey | KXLVVZODLGHOIC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |