C37H39ClF3N7O2 — CID 159074403
2-[benzyl(methyl)amino]-N-(2-phenoxyethyl)-4-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide;1-benzyl-1-methylguanidine;hydrochloride (PubChem CID 159074403) has the molecular formula C37H39ClF3N7O2 and a molecular weight of 706.21 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-N-(2-phenoxyethyl)-4-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide;1-benzyl-1-methylguanidine;hydrochloride.
| Compound Name | 2-[benzyl(methyl)amino]-N-(2-phenoxyethyl)-4-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide;1-benzyl-1-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 159074403 |
| Molecular Formula | C37H39ClF3N7O2 |
| Molecular Weight | 706.21 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | 2-[benzyl(methyl)amino]-N-(2-phenoxyethyl)-4-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxamide;1-benzyl-1-methylguanidine;hydrochloride |
| SMILES | CN(Cc1ccccc1)c1ncc(C(=O)NCCOc2ccccc2)c(-c2ccc(C(F)(F)F)cc2)n1.Cl.[H]/N=C(\N)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C28H25F3N4O2.C9H13N3.ClH/c1-35(19-20-8-4-2-5-9-20)27-33-18-24(26(36)32-16-17-37-23-10-6-3-7-11-23)25(34-27)21-12-14-22(15-13-21)28(29,30)31;1-12(9(10)11)7-8-5-3-2-4-6-8;/h2-15,18H,16-17,19H2,1H3,(H,32,36);2-6H,7H2,1H3,(H3,10,11);1H |
| InChIKey | XRSHCJDXNHYGHG-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.21 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|