C28H35FN2O3 — CID 159075055
2-(2-cyclopropylphenyl)-2-[(3R,4S)-3-fluoro-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 159075055) has the molecular formula C28H35FN2O3 and a molecular weight of 466.60 g/mol. Its IUPAC name is 2-(2-cyclopropylphenyl)-2-[(3R,4S)-3-fluoro-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(2-cyclopropylphenyl)-2-[(3R,4S)-3-fluoro-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 159075055 |
| Molecular Formula | C28H35FN2O3 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-(2-cyclopropylphenyl)-2-[(3R,4S)-3-fluoro-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1ccccc1C1CC1)N1C[C@@H](F)[C@@H](OCCCCc2ccc3c(n2)CCCC3)C1 |
| InChI | InChI=1S/C28H35FN2O3/c29-24-17-31(27(28(32)33)23-10-3-2-9-22(23)19-12-13-19)18-26(24)34-16-6-5-8-21-15-14-20-7-1-4-11-25(20)30-21/h2-3,9-10,14-15,19,24,26-27H,1,4-8,11-13,16-18H2,(H,32,33)/t24-,26+,27?/m1/s1 |
| InChIKey | ACKTUMDMXRFAQC-MFHGLKJTSA-N |
| XLogP | 5.03 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|