C29H48N4O5S2 — CID 159077146
4-[[4,6-bis(octylsulfonyl)-1,3,5-triazin-2-yl]amino]-2-tert-butylphenol (PubChem CID 159077146) has the molecular formula C29H48N4O5S2 and a molecular weight of 596.86 g/mol. Its IUPAC name is 4-[[4,6-bis(octylsulfonyl)-1,3,5-triazin-2-yl]amino]-2-tert-butylphenol.
| Compound Name | 4-[[4,6-bis(octylsulfonyl)-1,3,5-triazin-2-yl]amino]-2-tert-butylphenol |
|---|---|
| PubChem CID | 159077146 |
| Molecular Formula | C29H48N4O5S2 |
| Molecular Weight | 596.86 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 4-[[4,6-bis(octylsulfonyl)-1,3,5-triazin-2-yl]amino]-2-tert-butylphenol |
| SMILES | CCCCCCCCS(=O)(=O)c1nc(Nc2ccc(O)c(C(C)(C)C)c2)nc(S(=O)(=O)CCCCCCCC)n1 |
| InChI | InChI=1S/C29H48N4O5S2/c1-6-8-10-12-14-16-20-39(35,36)27-31-26(30-23-18-19-25(34)24(22-23)29(3,4)5)32-28(33-27)40(37,38)21-17-15-13-11-9-7-2/h18-19,22,34H,6-17,20-21H2,1-5H3,(H,30,31,32,33) |
| InChIKey | KAJVWSVTSCTLBR-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.86 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|