C26H44N4O7S2 — CID 174750524
6-[(3,5-ditert-butyl-4-hydroxyanilino)methyl]-1,3,5-triazine-2,4-disulfonic acid;octane (PubChem CID 174750524) has the molecular formula C26H44N4O7S2 and a molecular weight of 588.79 g/mol. Its IUPAC name is 6-[(3,5-ditert-butyl-4-hydroxyanilino)methyl]-1,3,5-triazine-2,4-disulfonic acid;octane.
| Compound Name | 6-[(3,5-ditert-butyl-4-hydroxyanilino)methyl]-1,3,5-triazine-2,4-disulfonic acid;octane |
|---|---|
| PubChem CID | 174750524 |
| Molecular Formula | C26H44N4O7S2 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 6-[(3,5-ditert-butyl-4-hydroxyanilino)methyl]-1,3,5-triazine-2,4-disulfonic acid;octane |
| SMILES | CC(C)(C)c1cc(NCc2nc(S(=O)(=O)O)nc(S(=O)(=O)O)n2)cc(C(C)(C)C)c1O.CCCCCCCC |
| InChI | InChI=1S/C18H26N4O7S2.C8H18/c1-17(2,3)11-7-10(8-12(14(11)23)18(4,5)6)19-9-13-20-15(30(24,25)26)22-16(21-13)31(27,28)29;1-3-5-7-8-6-4-2/h7-8,19,23H,9H2,1-6H3,(H,24,25,26)(H,27,28,29);3-8H2,1-2H3 |
| InChIKey | LDHMUOOEDRBLOC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|