C19H37N3O3S — CID 174836674
4,6-ditert-butyl-1,3,5-triazine-2-sulfonic acid;octane (PubChem CID 174836674) has the molecular formula C19H37N3O3S and a molecular weight of 387.59 g/mol. Its IUPAC name is 4,6-ditert-butyl-1,3,5-triazine-2-sulfonic acid;octane.
| Compound Name | 4,6-ditert-butyl-1,3,5-triazine-2-sulfonic acid;octane |
|---|---|
| PubChem CID | 174836674 |
| Molecular Formula | C19H37N3O3S |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 4,6-ditert-butyl-1,3,5-triazine-2-sulfonic acid;octane |
| SMILES | CC(C)(C)c1nc(C(C)(C)C)nc(S(=O)(=O)O)n1.CCCCCCCC |
| InChI | InChI=1S/C11H19N3O3S.C8H18/c1-10(2,3)7-12-8(11(4,5)6)14-9(13-7)18(15,16)17;1-3-5-7-8-6-4-2/h1-6H3,(H,15,16,17);3-8H2,1-2H3 |
| InChIKey | XMKCHUIPUBVCGG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|