C54H80N4O2 — CID 134574572
2,6-ditert-butyl-4-[2,3,7,8-tetrabutyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-5,10-dihydropyrazino[2,3-g]quinoxalin-10-yl]phenol (PubChem CID 134574572) has the molecular formula C54H80N4O2 and a molecular weight of 817.26 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2,3,7,8-tetrabutyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-5,10-dihydropyrazino[2,3-g]quinoxalin-10-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[2,3,7,8-tetrabutyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-5,10-dihydropyrazino[2,3-g]quinoxalin-10-yl]phenol |
|---|---|
| PubChem CID | 134574572 |
| Molecular Formula | C54H80N4O2 |
| Molecular Weight | 817.26 g/mol |
| Exact Mass | 816.63 |
| IUPAC Name | 2,6-ditert-butyl-4-[2,3,7,8-tetrabutyl-5-(3,5-ditert-butyl-4-hydroxyphenyl)-5,10-dihydropyrazino[2,3-g]quinoxalin-10-yl]phenol |
| SMILES | CCCCc1nc2c(nc1CCCC)C(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1nc(CCCC)c(CCCC)nc1C2c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C54H80N4O2/c1-17-21-25-39-40(26-22-18-2)56-46-44(34-31-37(53(11,12)13)50(60)38(32-34)54(14,15)16)48-47(57-41(27-23-19-3)42(58-48)28-24-20-4)43(45(46)55-39)33-29-35(51(5,6)7)49(59)36(30-33)52(8,9)10/h29-32,43-44,59-60H,17-28H2,1-16H3 |
| InChIKey | CKTAUZBHAXQIDT-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.26 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |