sodium 3-octoxyphenolate

C14H21NaO2 — CID 159078373

IUPACsodium 3-octoxyphenolate
SMILESCCCCCCCCOc1cccc([O-])c1.[Na+]
InChIInChI=1S/C14H22O2.Na/c1-2-3-4-5-6-7-11-16-14-10-8-9-13(15)12-14;/h8-10,12,15H,2-7,11H2,1H3;/q;+1/p-1
InChIKeyKANOHTSXSAMWKW-UHFFFAOYSA-M
MW244.31 g/mol
LogP0.50
Rot. Bonds8

About sodium 3-octoxyphenolate

sodium 3-octoxyphenolate (PubChem CID 159078373) has the molecular formula C14H21NaO2 and a molecular weight of 244.31 g/mol. Its IUPAC name is sodium 3-octoxyphenolate.

Molecular Properties

Compound Namesodium 3-octoxyphenolate
PubChem CID159078373
Molecular FormulaC14H21NaO2
Molecular Weight244.31 g/mol
Exact Mass244.14
IUPAC Namesodium 3-octoxyphenolate
SMILESCCCCCCCCOc1cccc([O-])c1.[Na+]
InChIInChI=1S/C14H22O2.Na/c1-2-3-4-5-6-7-11-16-14-10-8-9-13(15)12-14;/h8-10,12,15H,2-7,11H2,1H3;/q;+1/p-1
InChIKeyKANOHTSXSAMWKW-UHFFFAOYSA-M
XLogP0.50
TPSA32.29 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.31
LogP ≤ 50.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze sodium 3-octoxyphenolate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3-octoxyphenolate?
The IUPAC name of sodium 3-octoxyphenolate (CID 159078373) is sodium 3-octoxyphenolate.
What is the SMILES notation for sodium 3-octoxyphenolate?
The canonical SMILES for sodium 3-octoxyphenolate is CCCCCCCCOc1cccc([O-])c1.[Na+].
What is the InChIKey of sodium 3-octoxyphenolate?
The InChIKey is KANOHTSXSAMWKW-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H22O2.Na/c1-2-3-4-5-6-7-11-16-14-10-8-9-13(15)12-14;/h8-10,12,15H,2-7,11H2,1H3;/q;+1/p-1.
What are the key properties of sodium 3-octoxyphenolate?
sodium 3-octoxyphenolate has a molecular weight of 244.31 g/mol, XLogP of 0.50, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-octoxyphenolate is sourced from PubChem (CID 159078373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).