About sodium 3-octoxyphenolate
sodium 3-octoxyphenolate (PubChem CID 159078373) has the molecular formula C14H21NaO2
and a molecular weight of 244.31 g/mol. Its IUPAC name is sodium 3-octoxyphenolate.
Molecular Properties
| Compound Name | sodium 3-octoxyphenolate |
| PubChem CID | 159078373 |
| Molecular Formula | C14H21NaO2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | sodium 3-octoxyphenolate |
| SMILES | CCCCCCCCOc1cccc([O-])c1.[Na+] |
| InChI | InChI=1S/C14H22O2.Na/c1-2-3-4-5-6-7-11-16-14-10-8-9-13(15)12-14;/h8-10,12,15H,2-7,11H2,1H3;/q;+1/p-1 |
| InChIKey | KANOHTSXSAMWKW-UHFFFAOYSA-M |
| XLogP | 0.50 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-octoxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-octoxyphenolate?
The IUPAC name of sodium 3-octoxyphenolate (CID 159078373) is sodium 3-octoxyphenolate.
What is the SMILES notation for sodium 3-octoxyphenolate?
The canonical SMILES for sodium 3-octoxyphenolate is CCCCCCCCOc1cccc([O-])c1.[Na+].
What is the InChIKey of sodium 3-octoxyphenolate?
The InChIKey is KANOHTSXSAMWKW-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H22O2.Na/c1-2-3-4-5-6-7-11-16-14-10-8-9-13(15)12-14;/h8-10,12,15H,2-7,11H2,1H3;/q;+1/p-1.
What are the key properties of sodium 3-octoxyphenolate?
sodium 3-octoxyphenolate has a molecular weight of 244.31 g/mol, XLogP of 0.50, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-octoxyphenolate is sourced from PubChem (CID 159078373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).