C12H18F6NOP — CID 159083135
2-(cyclohexylmethoxy)pyridine;hydron;hexafluorophosphate (PubChem CID 159083135) has the molecular formula C12H18F6NOP and a molecular weight of 337.24 g/mol. Its IUPAC name is 2-(cyclohexylmethoxy)pyridine;hydron;hexafluorophosphate.
| Compound Name | 2-(cyclohexylmethoxy)pyridine;hydron;hexafluorophosphate |
|---|---|
| PubChem CID | 159083135 |
| Molecular Formula | C12H18F6NOP |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-(cyclohexylmethoxy)pyridine;hydron;hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.[H+].c1ccc(OCC2CCCCC2)nc1 |
| InChI | InChI=1S/C12H17NO.F6P/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13-12;1-7(2,3,4,5)6/h4-5,8-9,11H,1-3,6-7,10H2;/q;-1/p+1 |
| InChIKey | YWFGHJGVERTVBT-UHFFFAOYSA-O |
| XLogP | 6.54 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|