About 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine
3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 15908421) has the molecular formula C22H28F3N
and a molecular weight of 363.47 g/mol. Its IUPAC name is 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine |
| PubChem CID | 15908421 |
| Molecular Formula | C22H28F3N |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | CC(C)N(CCC(c1ccccc1)c1ccccc1C(F)(F)F)C(C)C |
| InChI | InChI=1S/C22H28F3N/c1-16(2)26(17(3)4)15-14-19(18-10-6-5-7-11-18)20-12-8-9-13-21(20)22(23,24)25/h5-13,16-17,19H,14-15H2,1-4H3 |
| InChIKey | SKNXXBZNDOHSJM-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine?
The IUPAC name of 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine (CID 15908421) is 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine.
What is the SMILES notation for 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine?
The canonical SMILES for 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine is CC(C)N(CCC(c1ccccc1)c1ccccc1C(F)(F)F)C(C)C.
What is the InChIKey of 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine?
The InChIKey is SKNXXBZNDOHSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28F3N/c1-16(2)26(17(3)4)15-14-19(18-10-6-5-7-11-18)20-12-8-9-13-21(20)22(23,24)25/h5-13,16-17,19H,14-15H2,1-4H3.
What are the key properties of 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine?
3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine has a molecular weight of 363.47 g/mol, XLogP of 6.35, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-N,N-di(propan-2-yl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine is sourced from PubChem (CID 15908421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).