C19H36N2S — CID 159085641
N'-decyl-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine (PubChem CID 159085641) has the molecular formula C19H36N2S and a molecular weight of 324.58 g/mol. Its IUPAC name is N'-decyl-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-decyl-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 159085641 |
| Molecular Formula | C19H36N2S |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | N'-decyl-N,N-dimethyl-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine |
| SMILES | CCCCCCCCCCN(CCN(C)C)Cc1cccs1 |
| InChI | InChI=1S/C19H36N2S/c1-4-5-6-7-8-9-10-11-14-21(16-15-20(2)3)18-19-13-12-17-22-19/h12-13,17H,4-11,14-16,18H2,1-3H3 |
| InChIKey | RTGIUNNLAMDBSG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|