C48H96O9Si3 — CID 159086772
(3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-propyloxan-2-one;bis((3S,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-propyloxan-2-one) (PubChem CID 159086772) has the molecular formula C48H96O9Si3 and a molecular weight of 901.54 g/mol. Its IUPAC name is (3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-propyloxan-2-one;bis((3S,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-propyloxan-2-one).
| Compound Name | (3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-propyloxan-2-one;bis((3S,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-propyloxan-2-one) |
|---|---|
| PubChem CID | 159086772 |
| Molecular Formula | C48H96O9Si3 |
| Molecular Weight | 901.54 g/mol |
| Exact Mass | 900.64 |
| IUPAC Name | (3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-propyloxan-2-one;bis((3S,4S,5R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-3,5-dimethyl-6-propyloxan-2-one) |
| SMILES | CCC[C@@H]1OC(=O)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C.CCC[C@H]1OC(=O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C.CCC[C@H]1OC(=O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/3C16H32O3Si/c3*1-9-10-13-11(2)14(12(3)15(17)18-13)19-20(7,8)16(4,5)6/h3*11-14H,9-10H2,1-8H3/t2*11-,12+,13-,14+;11-,12-,13+,14-/m111/s1 |
| InChIKey | KBNOJVQJUIWXMW-UTUGLWCGSA-N |
| XLogP | 13.12 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.54 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|