C27H27N — CID 159088701
4-(2,6-dideuterio-6-phenyl-2-adamantyl)-2-phenylpyridine (PubChem CID 159088701) has the molecular formula C27H27N and a molecular weight of 367.53 g/mol. Its IUPAC name is 4-(2,6-dideuterio-6-phenyl-2-adamantyl)-2-phenylpyridine.
| Compound Name | 4-(2,6-dideuterio-6-phenyl-2-adamantyl)-2-phenylpyridine |
|---|---|
| PubChem CID | 159088701 |
| Molecular Formula | C27H27N |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 4-(2,6-dideuterio-6-phenyl-2-adamantyl)-2-phenylpyridine |
| SMILES | [2H]C1(c2ccccc2)C2CC3CC1CC(C2)C3([2H])c1ccnc(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H27N/c1-3-7-18(8-4-1)25-17-20(11-12-28-25)27-23-13-21-14-24(27)16-22(15-23)26(21)19-9-5-2-6-10-19/h1-12,17,21-24,26-27H,13-16H2/i26D,27D |
| InChIKey | YRIHFENHGPMGKA-FOXYNOLNSA-N |
| XLogP | 6.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |