C25H25N — CID 166503402
4-[4-(2-deuterio-2-bicyclo[2.2.2]octanyl)phenyl]-2-phenylpyridine (PubChem CID 166503402) has the molecular formula C25H25N and a molecular weight of 340.49 g/mol. Its IUPAC name is 4-[4-(2-deuterio-2-bicyclo[2.2.2]octanyl)phenyl]-2-phenylpyridine.
| Compound Name | 4-[4-(2-deuterio-2-bicyclo[2.2.2]octanyl)phenyl]-2-phenylpyridine |
|---|---|
| PubChem CID | 166503402 |
| Molecular Formula | C25H25N |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 4-[4-(2-deuterio-2-bicyclo[2.2.2]octanyl)phenyl]-2-phenylpyridine |
| SMILES | [2H]C1(c2ccc(-c3ccnc(-c4ccccc4)c3)cc2)CC2CCC1CC2 |
| InChI | InChI=1S/C25H25N/c1-2-4-22(5-3-1)25-17-23(14-15-26-25)19-10-12-21(13-11-19)24-16-18-6-8-20(24)9-7-18/h1-5,10-15,17-18,20,24H,6-9,16H2/i24D |
| InChIKey | SXWAHGWMONBUDY-CORJAIEOSA-N |
| XLogP | 6.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |