C25H52O4S2 — CID 159090014
1,1-bis(decylsulfanyl)-2,2-bis(hydroxymethyl)propane-1,3-diol (PubChem CID 159090014) has the molecular formula C25H52O4S2 and a molecular weight of 480.82 g/mol. Its IUPAC name is 1,1-bis(decylsulfanyl)-2,2-bis(hydroxymethyl)propane-1,3-diol.
| Compound Name | 1,1-bis(decylsulfanyl)-2,2-bis(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 159090014 |
| Molecular Formula | C25H52O4S2 |
| Molecular Weight | 480.82 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | 1,1-bis(decylsulfanyl)-2,2-bis(hydroxymethyl)propane-1,3-diol |
| SMILES | CCCCCCCCCCSC(O)(SCCCCCCCCCC)C(CO)(CO)CO |
| InChI | InChI=1S/C25H52O4S2/c1-3-5-7-9-11-13-15-17-19-30-25(29,24(21-26,22-27)23-28)31-20-18-16-14-12-10-8-6-4-2/h26-29H,3-23H2,1-2H3 |
| InChIKey | LCJMJONDHIYBFE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.82 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|