C31H21NO — CID 159094045
19-phenyl-11,12-bis(trideuteriomethyl)-22-oxa-9-azahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(14),2,4,6,8,10,12,15(23),16(21),17,19,24-dodecaene (PubChem CID 159094045) has the molecular formula C31H21NO and a molecular weight of 429.55 g/mol. Its IUPAC name is 19-phenyl-11,12-bis(trideuteriomethyl)-22-oxa-9-azahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(14),2,4,6,8,10,12,15(23),16(21),17,19,24-dodecaene.
| Compound Name | 19-phenyl-11,12-bis(trideuteriomethyl)-22-oxa-9-azahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(14),2,4,6,8,10,12,15(23),16(21),17,19,24-dodecaene |
|---|---|
| PubChem CID | 159094045 |
| Molecular Formula | C31H21NO |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 19-phenyl-11,12-bis(trideuteriomethyl)-22-oxa-9-azahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(14),2,4,6,8,10,12,15(23),16(21),17,19,24-dodecaene |
| SMILES | [2H]C([2H])([2H])c1cnc2c3ccccc3c3ccc4oc5cc(-c6ccccc6)ccc5c4c3c2c1C([2H])([2H])[2H] |
| InChI | InChI=1S/C31H21NO/c1-18-17-32-31-24-11-7-6-10-22(24)23-14-15-26-29(30(23)28(31)19(18)2)25-13-12-21(16-27(25)33-26)20-8-4-3-5-9-20/h3-17H,1-2H3/i1D3,2D3 |
| InChIKey | NQCIHNRIEBWTJZ-WFGJKAKNSA-N |
| XLogP | 8.72 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|