C28H23NO — CID 162454667
3-tert-butyl-4-(trideuteriomethyl)-23-oxa-6-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(25),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene (PubChem CID 162454667) has the molecular formula C28H23NO and a molecular weight of 392.52 g/mol. Its IUPAC name is 3-tert-butyl-4-(trideuteriomethyl)-23-oxa-6-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(25),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene.
| Compound Name | 3-tert-butyl-4-(trideuteriomethyl)-23-oxa-6-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(25),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene |
|---|---|
| PubChem CID | 162454667 |
| Molecular Formula | C28H23NO |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-tert-butyl-4-(trideuteriomethyl)-23-oxa-6-azahexacyclo[12.11.0.02,7.08,13.016,24.017,22]pentacosa-1(25),2,4,6,8,10,12,14,16(24),17,19,21-dodecaene |
| SMILES | [2H]C([2H])([2H])c1cnc2c3ccccc3c3cc4c(cc3c2c1C(C)(C)C)oc1ccccc14 |
| InChI | InChI=1S/C28H23NO/c1-16-15-29-27-19-11-6-5-9-17(19)20-13-21-18-10-7-8-12-23(18)30-24(21)14-22(20)25(27)26(16)28(2,3)4/h5-15H,1-4H3/i1D3 |
| InChIKey | DHPWSYFWTRNTTJ-FIBGUPNXSA-N |
| XLogP | 8.05 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|