C41H55NSi — CID 15909450
8-methyl-8,8'-spirobi[8-silanuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene];tetrabutylazanium (PubChem CID 15909450) has the molecular formula C41H55NSi and a molecular weight of 589.98 g/mol. Its IUPAC name is 8-methyl-8,8'-spirobi[8-silanuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene];tetrabutylazanium.
| Compound Name | 8-methyl-8,8'-spirobi[8-silanuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene];tetrabutylazanium |
|---|---|
| PubChem CID | 15909450 |
| Molecular Formula | C41H55NSi |
| Molecular Weight | 589.98 g/mol |
| Exact Mass | 589.41 |
| IUPAC Name | 8-methyl-8,8'-spirobi[8-silanuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene];tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.C[Si-]12(c3ccccc3-c3ccccc31)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C25H19Si.C16H36N/c1-26(22-14-6-2-10-18(22)19-11-3-7-15-23(19)26)24-16-8-4-12-20(24)21-13-5-9-17-25(21)26;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h2-17H,1H3;5-16H2,1-4H3/q-1;+1 |
| InChIKey | YIQYECYHCNVLAX-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.98 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|