C29H26Cl2F3N7O2 — CID 159098898
7-(3-amino-2,6-dichloro-4,5-difluorophenyl)-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-(4-prop-2-enoylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 159098898) has the molecular formula C29H26Cl2F3N7O2 and a molecular weight of 632.47 g/mol. Its IUPAC name is 7-(3-amino-2,6-dichloro-4,5-difluorophenyl)-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-(4-prop-2-enoylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 7-(3-amino-2,6-dichloro-4,5-difluorophenyl)-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-(4-prop-2-enoylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 159098898 |
| Molecular Formula | C29H26Cl2F3N7O2 |
| Molecular Weight | 632.47 g/mol |
| Exact Mass | 631.15 |
| IUPAC Name | 7-(3-amino-2,6-dichloro-4,5-difluorophenyl)-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-(4-prop-2-enoylpiperazin-1-yl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n(-c3c(C)ccnc3C(C)C)c3nc(-c4c(Cl)c(N)c(F)c(F)c4Cl)c(F)cc23)CC1 |
| InChI | InChI=1S/C29H26Cl2F3N7O2/c1-5-17(42)39-8-10-40(11-9-39)27-15-12-16(32)25(18-19(30)21(33)22(34)23(35)20(18)31)37-28(15)41(29(43)38-27)26-14(4)6-7-36-24(26)13(2)3/h5-7,12-13H,1,8-11,35H2,2-4H3 |
| InChIKey | JRVMCNSTKLSNSW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|