C27H25Cl2F3N6O — CID 163716638
7-(3-amino-2,6-dichloro-4,5-difluorophenyl)-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-piperidin-1-ylpyrido[2,3-d]pyrimidin-2-one (PubChem CID 163716638) has the molecular formula C27H25Cl2F3N6O and a molecular weight of 577.44 g/mol. Its IUPAC name is 7-(3-amino-2,6-dichloro-4,5-difluorophenyl)-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-piperidin-1-ylpyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 7-(3-amino-2,6-dichloro-4,5-difluorophenyl)-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-piperidin-1-ylpyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 163716638 |
| Molecular Formula | C27H25Cl2F3N6O |
| Molecular Weight | 577.44 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 7-(3-amino-2,6-dichloro-4,5-difluorophenyl)-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)-4-piperidin-1-ylpyrido[2,3-d]pyrimidin-2-one |
| SMILES | Cc1ccnc(C(C)C)c1-n1c(=O)nc(N2CCCCC2)c2cc(F)c(-c3c(Cl)c(N)c(F)c(F)c3Cl)nc21 |
| InChI | InChI=1S/C27H25Cl2F3N6O/c1-12(2)22-24(13(3)7-8-34-22)38-26-14(25(36-27(38)39)37-9-5-4-6-10-37)11-15(30)23(35-26)16-17(28)19(31)20(32)21(33)18(16)29/h7-8,11-12H,4-6,9-10,33H2,1-3H3 |
| InChIKey | ACTVGNIPMAXXOX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.44 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|