C29H29Cl2F3N6O — CID 163555989
7-(2-amino-3,5-dichloro-4,6-difluorophenyl)-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 163555989) has the molecular formula C29H29Cl2F3N6O and a molecular weight of 605.49 g/mol. Its IUPAC name is 7-(2-amino-3,5-dichloro-4,6-difluorophenyl)-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 7-(2-amino-3,5-dichloro-4,6-difluorophenyl)-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 163555989 |
| Molecular Formula | C29H29Cl2F3N6O |
| Molecular Weight | 605.49 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | 7-(2-amino-3,5-dichloro-4,6-difluorophenyl)-4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]-6-fluoro-1-(4-methyl-2-propan-2-yl-3-pyridinyl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | Cc1ccnc(C(C)C)c1-n1c(=O)nc(N2C[C@H](C)C[C@H](C)C2)c2cc(F)c(-c3c(N)c(Cl)c(F)c(Cl)c3F)nc21 |
| InChI | InChI=1S/C29H29Cl2F3N6O/c1-12(2)24-26(15(5)6-7-36-24)40-28-16(27(38-29(40)41)39-10-13(3)8-14(4)11-39)9-17(32)25(37-28)18-21(33)19(30)22(34)20(31)23(18)35/h6-7,9,12-14H,8,10-11,35H2,1-5H3/t13-,14+ |
| InChIKey | LMDFPIGBBLVZLD-OKILXGFUSA-N |
| XLogP | 7.06 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.49 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|