About 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine
5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine (PubChem CID 159099141) has the molecular formula C17H20Br2FN3O
and a molecular weight of 461.17 g/mol. Its IUPAC name is 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine.
Molecular Properties
| Compound Name | 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine |
| PubChem CID | 159099141 |
| Molecular Formula | C17H20Br2FN3O |
| Molecular Weight | 461.17 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine |
| SMILES | Brc1ccc(OCCN2CCCCC2)nc1.Fc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H17BrN2O.C5H3BrFN/c13-11-4-5-12(14-10-11)16-9-8-15-6-2-1-3-7-15;6-4-1-2-5(7)8-3-4/h4-5,10H,1-3,6-9H2;1-3H |
| InChIKey | KDBAHSHDZYZZAK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.17 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine?
The IUPAC name of 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine (CID 159099141) is 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine.
What is the SMILES notation for 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine?
The canonical SMILES for 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine is Brc1ccc(OCCN2CCCCC2)nc1.Fc1ccc(Br)cn1.
What is the InChIKey of 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine?
The InChIKey is KDBAHSHDZYZZAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2O.C5H3BrFN/c13-11-4-5-12(14-10-11)16-9-8-15-6-2-1-3-7-15;6-4-1-2-5(7)8-3-4/h4-5,10H,1-3,6-9H2;1-3H.
What are the key properties of 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine?
5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine has a molecular weight of 461.17 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-fluoropyridine;5-bromo-2-(2-piperidin-1-ylethoxy)pyridine is sourced from PubChem (CID 159099141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).