C24H42O3 — CID 159099614
5-butyl-3-methylcyclohex-2-en-1-ol;(5-butyl-3-methylcyclohex-2-en-1-yl) acetate (PubChem CID 159099614) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is 5-butyl-3-methylcyclohex-2-en-1-ol;(5-butyl-3-methylcyclohex-2-en-1-yl) acetate.
| Compound Name | 5-butyl-3-methylcyclohex-2-en-1-ol;(5-butyl-3-methylcyclohex-2-en-1-yl) acetate |
|---|---|
| PubChem CID | 159099614 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 5-butyl-3-methylcyclohex-2-en-1-ol;(5-butyl-3-methylcyclohex-2-en-1-yl) acetate |
| SMILES | CCCCC1CC(C)=CC(O)C1.CCCCC1CC(C)=CC(OC(C)=O)C1 |
| InChI | InChI=1S/C13H22O2.C11H20O/c1-4-5-6-12-7-10(2)8-13(9-12)15-11(3)14;1-3-4-5-10-6-9(2)7-11(12)8-10/h8,12-13H,4-7,9H2,1-3H3;7,10-12H,3-6,8H2,1-2H3 |
| InChIKey | KDCODJKXPFYJCF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|