C21H28N2O4S — CID 159100638
N-methyl-N-(4-phenylpiperidin-4-yl)acetamide;phenylmethanesulfonic acid (PubChem CID 159100638) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is N-methyl-N-(4-phenylpiperidin-4-yl)acetamide;phenylmethanesulfonic acid.
| Compound Name | N-methyl-N-(4-phenylpiperidin-4-yl)acetamide;phenylmethanesulfonic acid |
|---|---|
| PubChem CID | 159100638 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-methyl-N-(4-phenylpiperidin-4-yl)acetamide;phenylmethanesulfonic acid |
| SMILES | CC(=O)N(C)C1(c2ccccc2)CCNCC1.O=S(=O)(O)Cc1ccccc1 |
| InChI | InChI=1S/C14H20N2O.C7H8O3S/c1-12(17)16(2)14(8-10-15-11-9-14)13-6-4-3-5-7-13;8-11(9,10)6-7-4-2-1-3-5-7/h3-7,15H,8-11H2,1-2H3;1-5H,6H2,(H,8,9,10) |
| InChIKey | KDFQMKGXWLLVRY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|