C33H55BN2O5 — CID 159101825
tert-butyl 3-[3-tert-butyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate;isocyanic acid (PubChem CID 159101825) has the molecular formula C33H55BN2O5 and a molecular weight of 570.62 g/mol. Its IUPAC name is tert-butyl 3-[3-tert-butyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate;isocyanic acid.
| Compound Name | tert-butyl 3-[3-tert-butyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate;isocyanic acid |
|---|---|
| PubChem CID | 159101825 |
| Molecular Formula | C33H55BN2O5 |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.42 |
| IUPAC Name | tert-butyl 3-[3-tert-butyl-3-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)heptyl]-3,4-dihydro-1H-isoquinoline-2-carboxylate;isocyanic acid |
| SMILES | CC(C)(C)OC(=O)N1Cc2ccccc2CC1CCC(C)(CCCCB1OC(C)(C)C(C)(C)O1)C(C)(C)C.N=C=O |
| InChI | InChI=1S/C32H54BNO4.CHNO/c1-28(2,3)32(11,19-14-15-21-33-37-30(7,8)31(9,10)38-33)20-18-26-22-24-16-12-13-17-25(24)23-34(26)27(35)36-29(4,5)6;2-1-3/h12-13,16-17,26H,14-15,18-23H2,1-11H3;2H |
| InChIKey | KDJOZHWEDLTEBK-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|