C15H21BrN4O3 — CID 159102561
ethyl 3-(1-methyl-8-oxo-7H-imidazo[1,2-a]pyrazin-1-ium-6-yl)piperidine-1-carboxylate bromide (PubChem CID 159102561) has the molecular formula C15H21BrN4O3 and a molecular weight of 385.26 g/mol. Its IUPAC name is ethyl 3-(1-methyl-8-oxo-7H-imidazo[1,2-a]pyrazin-1-ium-6-yl)piperidine-1-carboxylate bromide.
| Compound Name | ethyl 3-(1-methyl-8-oxo-7H-imidazo[1,2-a]pyrazin-1-ium-6-yl)piperidine-1-carboxylate bromide |
|---|---|
| PubChem CID | 159102561 |
| Molecular Formula | C15H21BrN4O3 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | ethyl 3-(1-methyl-8-oxo-7H-imidazo[1,2-a]pyrazin-1-ium-6-yl)piperidine-1-carboxylate bromide |
| SMILES | CCOC(=O)N1CCCC(c2cn3cc[n+](C)c3c(=O)[nH]2)C1.[Br-] |
| InChI | InChI=1S/C15H20N4O3.BrH/c1-3-22-15(21)19-6-4-5-11(9-19)12-10-18-8-7-17(2)14(18)13(20)16-12;/h7-8,10-11H,3-6,9H2,1-2H3;1H |
| InChIKey | ZOGUVKOOXIQYNJ-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|