C16H23N4O3+ — CID 142876855
ethyl 4-(1-methyl-9-oxo-2,8-dihydropyrazino[1,2-a]pyrimidin-5-ium-7-yl)piperidine-1-carboxylate (PubChem CID 142876855) has the molecular formula C16H23N4O3+ and a molecular weight of 319.38 g/mol. Its IUPAC name is ethyl 4-(1-methyl-9-oxo-2,8-dihydropyrazino[1,2-a]pyrimidin-5-ium-7-yl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(1-methyl-9-oxo-2,8-dihydropyrazino[1,2-a]pyrimidin-5-ium-7-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142876855 |
| Molecular Formula | C16H23N4O3+ |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | ethyl 4-(1-methyl-9-oxo-2,8-dihydropyrazino[1,2-a]pyrimidin-5-ium-7-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(c2c[n+]3c(c(=O)[nH]2)N(C)CC=C3)CC1 |
| InChI | InChI=1S/C16H22N4O3/c1-3-23-16(22)19-9-5-12(6-10-19)13-11-20-8-4-7-18(2)15(20)14(21)17-13/h4,8,11-12H,3,5-7,9-10H2,1-2H3/p+1 |
| InChIKey | NFZSBERURDWNMB-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 69.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|