C31H39BN2O6S — CID 159103654
4,6-dimethyl-3-[3-[3-methyl-1-(1-prop-2-enylcyclopropyl)sulfonyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-4-yl]-3-oxopropyl]-1H-pyridin-2-one (PubChem CID 159103654) has the molecular formula C31H39BN2O6S and a molecular weight of 578.54 g/mol. Its IUPAC name is 4,6-dimethyl-3-[3-[3-methyl-1-(1-prop-2-enylcyclopropyl)sulfonyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-4-yl]-3-oxopropyl]-1H-pyridin-2-one.
| Compound Name | 4,6-dimethyl-3-[3-[3-methyl-1-(1-prop-2-enylcyclopropyl)sulfonyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-4-yl]-3-oxopropyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 159103654 |
| Molecular Formula | C31H39BN2O6S |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 4,6-dimethyl-3-[3-[3-methyl-1-(1-prop-2-enylcyclopropyl)sulfonyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-4-yl]-3-oxopropyl]-1H-pyridin-2-one |
| SMILES | C=CCC1(S(=O)(=O)n2cc(C)c3c(C(=O)CCc4c(C)cc(C)[nH]c4=O)cc(B4OC(C)(C)C(C)(C)O4)cc32)CC1 |
| InChI | InChI=1S/C31H39BN2O6S/c1-9-12-31(13-14-31)41(37,38)34-18-20(3)27-24(26(35)11-10-23-19(2)15-21(4)33-28(23)36)16-22(17-25(27)34)32-39-29(5,6)30(7,8)40-32/h9,15-18H,1,10-14H2,2-8H3,(H,33,36) |
| InChIKey | NZFWZGSCZBOCMW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|