C26H35N3O10 — CID 159103924
7-oxabicyclo[4.1.0]heptan-3-ylmethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate;1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 159103924) has the molecular formula C26H35N3O10 and a molecular weight of 549.58 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate;1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate;1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 159103924 |
| Molecular Formula | C26H35N3O10 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 7-oxabicyclo[4.1.0]heptane-3-carboxylate;1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=C(OCC1CCC2OC2C1)C1CCC2OC2C1.O=c1n(CC2CO2)c(=O)n(CC2CO2)c(=O)n1CC1CO1 |
| InChI | InChI=1S/C14H20O4.C12H15N3O6/c15-14(9-2-4-11-13(6-9)18-11)16-7-8-1-3-10-12(5-8)17-10;16-10-13(1-7-4-19-7)11(17)15(3-9-6-21-9)12(18)14(10)2-8-5-20-8/h8-13H,1-7H2;7-9H,1-6H2 |
| InChIKey | KDQGCASGENNNOG-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 154.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|