C19H32 — CID 15910454
1,3,5-tritert-butylcyclohepta-1,3,5-triene (PubChem CID 15910454) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is 1,3,5-tritert-butylcyclohepta-1,3,5-triene.
| Compound Name | 1,3,5-tritert-butylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 15910454 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 1,3,5-tritert-butylcyclohepta-1,3,5-triene |
| SMILES | CC(C)(C)C1=CCC(C(C)(C)C)=CC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C19H32/c1-17(2,3)14-10-11-15(18(4,5)6)13-16(12-14)19(7,8)9/h10,12-13H,11H2,1-9H3 |
| InChIKey | WTMQGEJZCBBUMK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |