C24H32N2O — CID 159104675
2-tert-butyl-1,3-dihydroisoindole;2-tert-butyl-3H-isoindol-1-one (PubChem CID 159104675) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-tert-butyl-1,3-dihydroisoindole;2-tert-butyl-3H-isoindol-1-one.
| Compound Name | 2-tert-butyl-1,3-dihydroisoindole;2-tert-butyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 159104675 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 2-tert-butyl-1,3-dihydroisoindole;2-tert-butyl-3H-isoindol-1-one |
| SMILES | CC(C)(C)N1Cc2ccccc2C1.CC(C)(C)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C12H15NO.C12H17N/c1-12(2,3)13-8-9-6-4-5-7-10(9)11(13)14;1-12(2,3)13-8-10-6-4-5-7-11(10)9-13/h4-7H,8H2,1-3H3;4-7H,8-9H2,1-3H3 |
| InChIKey | KDSOGKZSXSJNBD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |