About 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol
2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol (PubChem CID 159105247) has the molecular formula C12H16N2O4S
and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol.
Molecular Properties
| Compound Name | 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol |
| PubChem CID | 159105247 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol |
| SMILES | NCCS(=O)(=O)O.Nc1ccc2cccc(O)c2c1 |
| InChI | InChI=1S/C10H9NO.C2H7NO3S/c11-8-5-4-7-2-1-3-10(12)9(7)6-8;3-1-2-7(4,5)6/h1-6,12H,11H2;1-3H2,(H,4,5,6) |
| InChIKey | KDUMGPDNJHXBFY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol?
The IUPAC name of 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol (CID 159105247) is 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol.
What is the SMILES notation for 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol?
The canonical SMILES for 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol is NCCS(=O)(=O)O.Nc1ccc2cccc(O)c2c1.
What is the InChIKey of 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol?
The InChIKey is KDUMGPDNJHXBFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.C2H7NO3S/c11-8-5-4-7-2-1-3-10(12)9(7)6-8;3-1-2-7(4,5)6/h1-6,12H,11H2;1-3H2,(H,4,5,6).
What are the key properties of 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol?
2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol has a molecular weight of 284.34 g/mol, XLogP of 0.96, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanesulfonic acid;7-aminonaphthalen-1-ol is sourced from PubChem (CID 159105247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).