C16H30N2O4S3 — CID 159105478
2-amino-2-(4-methyl-1-sulfanylcyclohexyl)acetic acid;2-amino-2-(4-sulfanylthian-4-yl)acetic acid (PubChem CID 159105478) has the molecular formula C16H30N2O4S3 and a molecular weight of 410.63 g/mol. Its IUPAC name is 2-amino-2-(4-methyl-1-sulfanylcyclohexyl)acetic acid;2-amino-2-(4-sulfanylthian-4-yl)acetic acid.
| Compound Name | 2-amino-2-(4-methyl-1-sulfanylcyclohexyl)acetic acid;2-amino-2-(4-sulfanylthian-4-yl)acetic acid |
|---|---|
| PubChem CID | 159105478 |
| Molecular Formula | C16H30N2O4S3 |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-amino-2-(4-methyl-1-sulfanylcyclohexyl)acetic acid;2-amino-2-(4-sulfanylthian-4-yl)acetic acid |
| SMILES | CC1CCC(S)(C(N)C(=O)O)CC1.NC(C(=O)O)C1(S)CCSCC1 |
| InChI | InChI=1S/C9H17NO2S.C7H13NO2S2/c1-6-2-4-9(13,5-3-6)7(10)8(11)12;8-5(6(9)10)7(11)1-3-12-4-2-7/h6-7,13H,2-5,10H2,1H3,(H,11,12);5,11H,1-4,8H2,(H,9,10) |
| InChIKey | KDVCTQJYWZYWEM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|