C7H14ClNO2S2 — CID 86736267
2-amino-2-(4-sulfanylthian-4-yl)acetic acid;hydrochloride (PubChem CID 86736267) has the molecular formula C7H14ClNO2S2 and a molecular weight of 243.78 g/mol. Its IUPAC name is 2-amino-2-(4-sulfanylthian-4-yl)acetic acid;hydrochloride.
| Compound Name | 2-amino-2-(4-sulfanylthian-4-yl)acetic acid;hydrochloride |
|---|---|
| PubChem CID | 86736267 |
| Molecular Formula | C7H14ClNO2S2 |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 2-amino-2-(4-sulfanylthian-4-yl)acetic acid;hydrochloride |
| SMILES | Cl.NC(C(=O)O)C1(S)CCSCC1 |
| InChI | InChI=1S/C7H13NO2S2.ClH/c8-5(6(9)10)7(11)1-3-12-4-2-7;/h5,11H,1-4,8H2,(H,9,10);1H |
| InChIKey | VWCPOGWZJFJYJO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|