C4H12N2O4S2 — CID 159105786
N',N'-dimethyl-N-methylsulfonylmethanesulfonohydrazide (PubChem CID 159105786) has the molecular formula C4H12N2O4S2 and a molecular weight of 216.28 g/mol. Its IUPAC name is N',N'-dimethyl-N-methylsulfonylmethanesulfonohydrazide.
| Compound Name | N',N'-dimethyl-N-methylsulfonylmethanesulfonohydrazide |
|---|---|
| PubChem CID | 159105786 |
| Molecular Formula | C4H12N2O4S2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | N',N'-dimethyl-N-methylsulfonylmethanesulfonohydrazide |
| SMILES | CN(C)N(S(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C4H12N2O4S2/c1-5(2)6(11(3,7)8)12(4,9)10/h1-4H3 |
| InChIKey | GFWBVPXKKRLTML-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|