C11H29NO2S — CID 91522077
N,N-dimethylmethanesulfonamide;ethane;hexane (PubChem CID 91522077) has the molecular formula C11H29NO2S and a molecular weight of 239.42 g/mol. Its IUPAC name is N,N-dimethylmethanesulfonamide;ethane;hexane.
| Compound Name | N,N-dimethylmethanesulfonamide;ethane;hexane |
|---|---|
| PubChem CID | 91522077 |
| Molecular Formula | C11H29NO2S |
| Molecular Weight | 239.42 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N,N-dimethylmethanesulfonamide;ethane;hexane |
| SMILES | CC.CCCCCC.CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C6H14.C3H9NO2S.C2H6/c1-3-5-6-4-2;1-4(2)7(3,5)6;1-2/h3-6H2,1-2H3;1-3H3;1-2H3 |
| InChIKey | NPCUMMPEXHFDGN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|