C17H15N3O — CID 159105946
1-(3-pyridin-3-yl-1H-isoindol-5-yl)pyrrolidin-2-one (PubChem CID 159105946) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 1-(3-pyridin-3-yl-1H-isoindol-5-yl)pyrrolidin-2-one.
| Compound Name | 1-(3-pyridin-3-yl-1H-isoindol-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 159105946 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-(3-pyridin-3-yl-1H-isoindol-5-yl)pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc2c(c1)C(c1cccnc1)=NC2 |
| InChI | InChI=1S/C17H15N3O/c21-16-4-2-8-20(16)14-6-5-12-11-19-17(15(12)9-14)13-3-1-7-18-10-13/h1,3,5-7,9-10H,2,4,8,11H2 |
| InChIKey | PCIVIVQLAZFFNC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |