C26H15Cl7N4 — CID 159106820
2-chloro-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;1,3-dichloro-2-(isocyanomethyl)benzene;2,6-dichloropyridine (PubChem CID 159106820) has the molecular formula C26H15Cl7N4 and a molecular weight of 631.61 g/mol. Its IUPAC name is 2-chloro-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;1,3-dichloro-2-(isocyanomethyl)benzene;2,6-dichloropyridine.
| Compound Name | 2-chloro-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;1,3-dichloro-2-(isocyanomethyl)benzene;2,6-dichloropyridine |
|---|---|
| PubChem CID | 159106820 |
| Molecular Formula | C26H15Cl7N4 |
| Molecular Weight | 631.61 g/mol |
| Exact Mass | 627.91 |
| IUPAC Name | 2-chloro-6-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;1,3-dichloro-2-(isocyanomethyl)benzene;2,6-dichloropyridine |
| SMILES | Clc1cccc(Cl)n1.[C-]#[N+]C(c1cccc(Cl)n1)c1c(Cl)cccc1Cl.[C-]#[N+]Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H7Cl3N2.C8H5Cl2N.C5H3Cl2N/c1-17-13(10-6-3-7-11(16)18-10)12-8(14)4-2-5-9(12)15;1-11-5-6-7(9)3-2-4-8(6)10;6-4-2-1-3-5(7)8-4/h2-7,13H;2-4H,5H2;1-3H |
| InChIKey | KDZKGNLMEYYJJI-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 34.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.61 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|