C67H44Br2NO2PS2 — CID 159107744
2-(7-bromo-9H-fluoren-2-yl)dibenzothiophene;2-[4-(4-bromo-2-nitrophenyl)phenyl]dibenzothiophene;triphenylphosphane (PubChem CID 159107744) has the molecular formula C67H44Br2NO2PS2 and a molecular weight of 1150.01 g/mol. Its IUPAC name is 2-(7-bromo-9H-fluoren-2-yl)dibenzothiophene;2-[4-(4-bromo-2-nitrophenyl)phenyl]dibenzothiophene;triphenylphosphane.
| Compound Name | 2-(7-bromo-9H-fluoren-2-yl)dibenzothiophene;2-[4-(4-bromo-2-nitrophenyl)phenyl]dibenzothiophene;triphenylphosphane |
|---|---|
| PubChem CID | 159107744 |
| Molecular Formula | C67H44Br2NO2PS2 |
| Molecular Weight | 1150.01 g/mol |
| Exact Mass | 1147.09 |
| IUPAC Name | 2-(7-bromo-9H-fluoren-2-yl)dibenzothiophene;2-[4-(4-bromo-2-nitrophenyl)phenyl]dibenzothiophene;triphenylphosphane |
| SMILES | Brc1ccc2c(c1)Cc1cc(-c3ccc4sc5ccccc5c4c3)ccc1-2.O=[N+]([O-])c1cc(Br)ccc1-c1ccc(-c2ccc3sc4ccccc4c3c2)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H15BrS.C24H14BrNO2S.C18H15P/c26-19-7-9-21-18(13-19)12-17-11-15(5-8-20(17)21)16-6-10-25-23(14-16)22-3-1-2-4-24(22)27-25;25-18-10-11-19(22(14-18)26(27)28)16-7-5-15(6-8-16)17-9-12-24-21(13-17)20-3-1-2-4-23(20)29-24;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-11,13-14H,12H2;1-14H;1-15H |
| InChIKey | KECHTXROZXMEDJ-UHFFFAOYSA-N |
| XLogP | 19.56 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1150.01 |
| LogP ≤ 5 | 19.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|