C16H26N2O3S — CID 159113600
2-[3-(tert-butylsulfamoyl)-4-methylphenyl]-N-propan-2-ylacetamide (PubChem CID 159113600) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is 2-[3-(tert-butylsulfamoyl)-4-methylphenyl]-N-propan-2-ylacetamide.
| Compound Name | 2-[3-(tert-butylsulfamoyl)-4-methylphenyl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 159113600 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-[3-(tert-butylsulfamoyl)-4-methylphenyl]-N-propan-2-ylacetamide |
| SMILES | Cc1ccc(CC(=O)NC(C)C)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H26N2O3S/c1-11(2)17-15(19)10-13-8-7-12(3)14(9-13)22(20,21)18-16(4,5)6/h7-9,11,18H,10H2,1-6H3,(H,17,19) |
| InChIKey | UCMWEEXFWPLFCZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |