C17H30BNO4S — CID 123647380
[3-(tert-butylsulfamoyl)-4-methylphenyl]-(2,3-dimethylbutan-2-yloxy)borinic acid (PubChem CID 123647380) has the molecular formula C17H30BNO4S and a molecular weight of 355.31 g/mol. Its IUPAC name is [3-(tert-butylsulfamoyl)-4-methylphenyl]-(2,3-dimethylbutan-2-yloxy)borinic acid.
| Compound Name | [3-(tert-butylsulfamoyl)-4-methylphenyl]-(2,3-dimethylbutan-2-yloxy)borinic acid |
|---|---|
| PubChem CID | 123647380 |
| Molecular Formula | C17H30BNO4S |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | [3-(tert-butylsulfamoyl)-4-methylphenyl]-(2,3-dimethylbutan-2-yloxy)borinic acid |
| SMILES | Cc1ccc(B(O)OC(C)(C)C(C)C)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H30BNO4S/c1-12(2)17(7,8)23-18(20)14-10-9-13(3)15(11-14)24(21,22)19-16(4,5)6/h9-12,19-20H,1-8H3 |
| InChIKey | QNEVMWGFVNAXIU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|