[2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid

C11H18BNO4S — CID 163342481

IUPAC[2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid
SMILESCc1ccc(B(O)O)c(S(=O)(=O)NC(C)(C)C)c1
InChIInChI=1S/C11H18BNO4S/c1-8-5-6-9(12(14)15)10(7-8)18(16,17)13-11(2,3)4/h5-7,13-15H,1-4H3
InChIKeyUTLGMLUPWCQMEN-UHFFFAOYSA-N
MW271.15 g/mol
LogP-0.25
Rot. Bonds3

About [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid

[2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid (PubChem CID 163342481) has the molecular formula C11H18BNO4S and a molecular weight of 271.15 g/mol. Its IUPAC name is [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid.

Molecular Properties

Compound Name[2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid
PubChem CID163342481
Molecular FormulaC11H18BNO4S
Molecular Weight271.15 g/mol
Exact Mass271.10
IUPAC Name[2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid
SMILESCc1ccc(B(O)O)c(S(=O)(=O)NC(C)(C)C)c1
InChIInChI=1S/C11H18BNO4S/c1-8-5-6-9(12(14)15)10(7-8)18(16,17)13-11(2,3)4/h5-7,13-15H,1-4H3
InChIKeyUTLGMLUPWCQMEN-UHFFFAOYSA-N
XLogP-0.25
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.15
LogP ≤ 5-0.25
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid?
The IUPAC name of [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid (CID 163342481) is [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid.
What is the SMILES notation for [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid?
The canonical SMILES for [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid is Cc1ccc(B(O)O)c(S(=O)(=O)NC(C)(C)C)c1.
What is the InChIKey of [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid?
The InChIKey is UTLGMLUPWCQMEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18BNO4S/c1-8-5-6-9(12(14)15)10(7-8)18(16,17)13-11(2,3)4/h5-7,13-15H,1-4H3.
What are the key properties of [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid?
[2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid has a molecular weight of 271.15 g/mol, XLogP of -0.25, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid is sourced from PubChem (CID 163342481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).