C20H20Cl3F2N3O4 — CID 159119007
ethyl 6-chloro-4-[(3,3-difluorocyclobutyl)amino]pyridine-3-carboxylate;ethyl 4,6-dichloropyridine-3-carboxylate (PubChem CID 159119007) has the molecular formula C20H20Cl3F2N3O4 and a molecular weight of 510.75 g/mol. Its IUPAC name is ethyl 6-chloro-4-[(3,3-difluorocyclobutyl)amino]pyridine-3-carboxylate;ethyl 4,6-dichloropyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-4-[(3,3-difluorocyclobutyl)amino]pyridine-3-carboxylate;ethyl 4,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 159119007 |
| Molecular Formula | C20H20Cl3F2N3O4 |
| Molecular Weight | 510.75 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | ethyl 6-chloro-4-[(3,3-difluorocyclobutyl)amino]pyridine-3-carboxylate;ethyl 4,6-dichloropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cl)cc1Cl.CCOC(=O)c1cnc(Cl)cc1NC1CC(F)(F)C1 |
| InChI | InChI=1S/C12H13ClF2N2O2.C8H7Cl2NO2/c1-2-19-11(18)8-6-16-10(13)3-9(8)17-7-4-12(14,15)5-7;1-2-13-8(12)5-4-11-7(10)3-6(5)9/h3,6-7H,2,4-5H2,1H3,(H,16,17);3-4H,2H2,1H3 |
| InChIKey | KFLHYWBYARRWOU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.75 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|