C9H11ClN2O2 — CID 159122040
(3S)-3-(4-chlorophenyl)-N',3-dihydroxypropanimidamide (PubChem CID 159122040) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-N',3-dihydroxypropanimidamide.
| Compound Name | (3S)-3-(4-chlorophenyl)-N',3-dihydroxypropanimidamide |
|---|---|
| PubChem CID | 159122040 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-N',3-dihydroxypropanimidamide |
| SMILES | NC(C[C@H](O)c1ccc(Cl)cc1)=NO |
| InChI | InChI=1S/C9H11ClN2O2/c10-7-3-1-6(2-4-7)8(13)5-9(11)12-14/h1-4,8,13-14H,5H2,(H2,11,12)/t8-/m0/s1 |
| InChIKey | KVXVDYBHRRPRCO-QMMMGPOBSA-N |
| XLogP | 1.51 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|